For research use only. Not for therapeutic Use.
Antroquinonol（Cat No.:I002446）is a bioactive compound derived from the medicinal mushroom Antrodia camphorata. Known for its broad spectrum of therapeutic properties, Antroquinonol exhibits potent anticancer, anti-inflammatory, and antioxidant effects. It inhibits the PI3K/Akt/mTOR pathway, leading to the suppression of cancer cell growth and induction of apoptosis. Additionally, Antroquinonol has shown potential in treating metabolic disorders, cardiovascular diseases, and neurodegenerative conditions. Its natural origin and multifaceted benefits make Antroquinonol a promising candidate for integrative medicine, contributing to advancements in cancer therapy and chronic disease management.
| Catalog Number | I002446 |
| CAS Number | 1010081-09-0 |
| Molecular Formula | C24H38O4 |
| Purity | ≥95% |
| IUPAC Name | (4R,5R,6R)-4-hydroxy-2,3-dimethoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
| InChI | InChI=1S/C24H38O4/c1-16(2)10-8-11-17(3)12-9-13-18(4)14-15-20-19(5)21(25)23(27-6)24(28-7)22(20)26/h10,12,14,19-20,22,26H,8-9,11,13,15H2,1-7H3/b17-12+,18-14+/t19-,20-,22-/m1/s1 |
| InChIKey | LJTSIMVOOOLKOL-FNRDIUJOSA-N |
| SMILES | CC1C(C(C(=C(C1=O)OC)OC)O)CC=C(C)CCC=C(C)CCC=C(C)C |
