For research use only. Not for therapeutic Use.
AP1867 (Cat.No:I019585) is a small molecule immunomodulator that functions as a potent inducer of the drug-activated signaling pathways. It specifically targets and activates the pro-apoptotic protein Bcl-2 family members, promoting cell death in cancerous cells. AP1867 has been studied for its potential in treating hematological malignancies, particularly in relapsed or refractory cases of leukemia and lymphoma. It also shows promise in improving immune responses by modulating immune cell function. Research is ongoing to explore its full therapeutic potential in oncology and immune-related disorders.
| Catalog Number | I019585 |
| CAS Number | 195514-23-9 |
| Molecular Formula | C₃₈H₄₇NO₁₁ |
| Purity | ≥95% |
| Target | Immunology/Inflammation |
| IUPAC Name | 2-[3-[(1R)-3-(3,4-dimethoxyphenyl)-1-[(2S)-1-[(2S)-2-(3,4,5-trimethoxyphenyl)butanoyl]piperidine-2-carbonyl]oxypropyl]phenoxy]acetic acid |
| InChI | InChI=1S/C38H47NO11/c1-7-28(26-21-33(46-4)36(48-6)34(22-26)47-5)37(42)39-18-9-8-13-29(39)38(43)50-30(25-11-10-12-27(20-25)49-23-35(40)41)16-14-24-15-17-31(44-2)32(19-24)45-3/h10-12,15,17,19-22,28-30H,7-9,13-14,16,18,23H2,1-6H3,(H,40,41)/t28-,29-,30+/m0/s1 |
| InChIKey | XCCRAOPQCACRFC-OIFRRMEBSA-N |
| SMILES | CC[C@@H](C1=CC(=C(C(=C1)OC)OC)OC)C(=O)N2CCCC[C@H]2C(=O)O[C@H](CCC3=CC(=C(C=C3)OC)OC)C4=CC(=CC=C4)OCC(=O)O |
