For research use only. Not for therapeutic Use.
AP39 (Item No. <span class=/itemid/>17100</span>) is a compound used to increase the levels of hydrogen sulfide (H<sub>2</sub>S) within mitochondria. It consists of a mitochondria-targeting motif (triphenylphosphonium) coupled to an H<sub>2</sub>S-donating moiety (dithiolethione) by an aliphatic linker. AP219 is a control compound for AP39, containing the triphenylphosphonium scaffold but lacking the H<sub>2</sub>S-releasing portion.
| Catalog Number | R065421 |
| CAS Number | 779282-36-9 |
| Synonyms | (9-carboxynonyl)triphenyl-phosphonium |
| Molecular Formula | C28H34O2P+ |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 9-carboxynonyl(triphenyl)phosphanium |
| InChI | InChI=1S/C28H33O2P/c29-28(30)23-15-4-2-1-3-5-16-24-31(25-17-9-6-10-18-25,26-19-11-7-12-20-26)27-21-13-8-14-22-27/h6-14,17-22H,1-5,15-16,23-24H2/p+1 |
| InChIKey | VOOZXZVXPXRBBF-UHFFFAOYSA-O |
| SMILES | C1=CC=C(C=C1)[P+](CCCCCCCCCC(=O)O)(C2=CC=CC=C2)C3=CC=CC=C3 |
| Reference | 1.Szczesny, B.,Módis, K.,Yanagi, K., et al. AP39, a novel mitochondria-targeted hydrogen sulfide donor, stimulates cellular bioenergetics, exerts cytoprotective effects and protects against the loss of mitochondrial DNA integrity in oxidatively stressed e |
