For research use only, not for therapeutic use.
Apcin-A（Cat No.:I016922）is a potent inhibitor of the anaphase-promoting complex/cyclosome (APC/C), a crucial regulator of the cell cycle. By selectively targeting the APC/C complex, Apcin-A disrupts the degradation of key cell cycle proteins, leading to cell cycle arrest in mitosis. This inhibition has significant potential for cancer research, as it impairs the uncontrolled proliferation of cancer cells. Apcin-A is widely used in studies exploring the mechanisms of cell cycle regulation, making it a valuable tool for developing novel anticancer therapies that target mitotic control pathways.
| Catalog Number | I016922 |
| CAS Number | 1683617-62-0 |
| Molecular Formula | C₁₀H₁₄Cl₃N₅O₂ |
| Purity | ≥95% |
| IUPAC Name | 3-aminopropyl N-[2,2,2-trichloro-1-(pyrimidin-2-ylamino)ethyl]carbamate |
| InChI | InChI=1S/C10H14Cl3N5O2/c11-10(12,13)7(17-8-15-4-2-5-16-8)18-9(19)20-6-1-3-14/h2,4-5,7H,1,3,6,14H2,(H,18,19)(H,15,16,17) |
| InChIKey | JQTSJVDIFMKETH-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)NC(C(Cl)(Cl)Cl)NC(=O)OCCCN |
| Reference | [1]. Chi JJ, et al. A novel strategy to block mitotic progression for targeted therapy. EBioMedicine. 2019 Oct 25. pii: S2352-3964(19)30677-2. |
