For research use only, not for therapeutic use.
Apcin（Cat No.:I011289）is a small molecule inhibitor that targets the anaphase-promoting complex/cyclosome (APC/C), a crucial E3 ubiquitin ligase responsible for regulating cell cycle progression. By inhibiting the APC/C, Apcin prevents the degradation of specific cell cycle proteins, thereby blocking the transition from metaphase to anaphase and leading to cell cycle arrest. Apcin is valuable in cancer research as it helps study the mechanisms of mitotic control and explore potential therapeutic strategies for tumors driven by dysregulated cell division. It offers a promising tool for investigating cell cycle regulation in oncology.
| Catalog Number | I011289 |
| CAS Number | 300815-04-7 |
| Synonyms | 3-(2-Methyl-5-nitroimidazol-1-yl)-N-(2,2,2-trichloro-1-phenylaminoethyl)propionamide |
| Molecular Formula | C13H14Cl3N7O4 |
| Purity | ≥95% |
| Solubility | Soluble to 100 mM in DMSO |
| Storage | room temp |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-[2,2,2-trichloro-1-(pyrimidin-2-ylamino)ethyl]carbamate |
| InChI | InChI=1S/C13H14Cl3N7O4/c1-8-19-7-9(23(25)26)22(8)5-6-27-12(24)21-10(13(14,15)16)20-11-17-3-2-4-18-11/h2-4,7,10H,5-6H2,1H3,(H,21,24)(H,17,18,20) |
| InChIKey | ZEXHXVOGJFGTRX-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1CCOC(=O)NC(C(Cl)(Cl)Cl)NC2=NC=CC=N2)[N+](=O)[O-] |
