For research use only. Not for therapeutic Use.
(+)-Aphidicolin（Cat No.:R015684）is a naturally occurring diterpenoid compound isolated from the fungus Cephalosporium aphidicola. It acts as a potent inhibitor of DNA polymerase, particularly DNA polymerase α, which plays a crucial role in DNA replication. By inhibiting this enzyme, (+)-aphidicolin prevents DNA synthesis, leading to cell cycle arrest and apoptosis. It is widely used in molecular biology to study DNA replication and cell division. Additionally, (+)-aphidicolin has shown potential in cancer research due to its ability to inhibit tumor cell proliferation, though its clinical application is limited due to toxicity concerns.
| CAS Number | 38966-21-1 |
| Synonyms | [3R-(3α,4α,4aα,6aβ,8β,9β,11aβ,11bβ)]-Tetradecahydro-3,9-dihydroxy-4,11b-dimethyl- 8,11a-methano-11aH-cyclohepta[a]naphthalene-4,9-dimethanol; Aphidicolin; ICI 69653; NSC 234714; (3α,4α,5α,17α)-3,17-Dihydroxy-4-methyl-9,15-cyclo-C,18-dinor-14,15-secoa |
| Molecular Formula | C20H34O4 |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | 4°C |
| IUPAC Name | (1S,2S,5R,6R,7R,10S,12R,13R)-6,13-bis(hydroxymethyl)-2,6-dimethyltetracyclo[10.3.1.01,10.02,7]hexadecane-5,13-diol |
| InChI | InChI=1S/C20H34O4/c1-17(11-21)15-4-3-13-9-14-10-19(13,7-8-20(14,24)12-22)18(15,2)6-5-16(17)23/h13-16,21-24H,3-12H2,1-2H3/t13-,14+,15-,16+,17-,18-,19-,20-/m0/s1 |
| InChIKey | NOFOAYPPHIUXJR-APNQCZIXSA-N |
| SMILES | C[C@]12CC[C@H]([C@@]([C@@H]1CC[C@@H]3[C@@]24CC[C@@]([C@H](C3)C4)(CO)O)(C)CO)O |
| Reference | <br /> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
