For research use only. Not for therapeutic Use.
Apigenin 7-O-malonylglucoside is found in chrysanthemum flowers[1].
| Catalog Number | I044951 |
| CAS Number | 86546-87-4 |
| Synonyms | 3-oxo-3-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methoxy]propanoic acid |
| Molecular Formula | C24H22O13 |
| Purity | ≥95% |
| InChI | InChI=1S/C24H22O13/c25-11-3-1-10(2-4-11)15-7-14(27)20-13(26)5-12(6-16(20)36-15)35-24-23(33)22(32)21(31)17(37-24)9-34-19(30)8-18(28)29/h1-7,17,21-26,31-33H,8-9H2,(H,28,29)/t17-,21-,22+,23-,24-/m1/s1 |
| InChIKey | JXWAQRJFONLTSI-ASDZUOGYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)COC(=O)CC(=O)O)O)O)O)O)O |
| Reference | [1]. Chen S M, et al. The identification of flavonoids and the expression of genes of anthocyanin biosynthesis in the chrysanthemum flowers[J]. Biologia Plantarum, 2012, 56(3):458-464. |
