For research use only. Not for therapeutic Use.
Apigenin (CAT: I003889) is a naturally occurring flavonoid found in various plants, including parsley, chamomile, and celery. It has been studied for its potential pharmacological properties, including antioxidant, anti-inflammatory, and anticancer activities. Apigenin has been shown to possess antioxidant properties by scavenging free radicals and reducing oxidative stress in cells. It also exhibits anti-inflammatory effects by inhibiting inflammatory mediators and pathways. Moreover, apigenin has demonstrated anticancer properties by inhibiting the proliferation of cancer cells, inducing cell cycle arrest, and promoting apoptosis. Due to its diverse biological activities, apigenin is being investigated for its potential therapeutic applications in various diseases, including cancer, cardiovascular disorders, and neurodegenerative diseases.
| Catalog Number | I003889 |
| CAS Number | 520-36-5 |
| Synonyms | Chamomile;Flavone;NSC 83244;Versulin |
| Molecular Formula | C₁₅H₁₀O₅ |
| Purity | ≥95% |
| Solubility | Soluble to 50 mM in DMSO |
| Storage | Desiccate at +4°C |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| InChI | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-7,16-18H |
| InChIKey | KZNIFHPLKGYRTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O |
