For research use only. Not for therapeutic Use.
Apigeninidin Chloride(Cat No.:M050628) is a naturally occurring 3-deoxyanthocyanidin, a type of flavonoid found in certain plants, known for its antioxidant, anti-inflammatory, and potential anticancer properties. This compound exhibits strong free radical scavenging abilities, making it valuable in research focused on oxidative stress and its impact on various diseases, including cancer, cardiovascular diseases, and neurodegenerative disorders. Apigeninidin Chloride also has potential applications in food and cosmetic industries due to its natural pigment properties. In scientific studies, it is explored for its role in modulating cellular pathways and its protective effects against oxidative damage and inflammation.
CAS Number | 1151-98-0 |
Synonyms | 3-desoxy Pelargonidin |
Molecular Formula | C15H11ClO4 |
Purity | ≥95% |
Target | Fungal |
Storage | -20°C |
IUPAC Name | 2-(4-hydroxyphenyl)chromenylium-5,7-diol;chloride |
InChI | InChI=1S/C15H10O4.ClH/c16-10-3-1-9(2-4-10)14-6-5-12-13(18)7-11(17)8-15(12)19-14;/h1-8H,(H2-,16,17,18);1H |
InChIKey | GYQDOAKHUGURPD-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=[O+]C3=CC(=CC(=C3C=C2)O)O)O.[Cl-] |