For research use only. Not for therapeutic Use.
Apocynin (Cat No.:I003751) is a natural compound derived from the roots of certain plants, such as Apocynum cannabinum. It possesses antioxidant and anti-inflammatory properties, which make it a valuable compound in biomedical research. Apocynin has been investigated for its potential therapeutic applications in conditions like cardiovascular diseases, neurodegenerative disorders, and inflammatory conditions. It acts by inhibiting the activation of NADPH oxidase, an enzyme involved in the generation of reactive oxygen species (ROS) and inflammation. By reducing oxidative stress and inflammation, apocynin may have beneficial effects on cellular health and various disease processes.
CAS Number | 498-02-2 |
Synonyms | Acetoguaiacone;Acetovanillone;NSC 2146;NSC 209524 |
Molecular Formula | C9H10O3 |
Purity | ≥95% |
Target | NADPH Oxidase |
Solubility | 10 mM in DMSO |
Storage | Room Temperature |
IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)ethanone |
InChI | InChI=1S/C9H10O3/c1-6(10)7-3-4-8(11)9(5-7)12-2/h3-5,11H,1-2H3 |
InChIKey | DFYRUELUNQRZTB-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC(=C(C=C1)O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |