For research use only. Not for therapeutic Use.
Apoptosis Activator 2 (CAT: I004894) is a small molecule compound that has been reported to induce apoptosis, or programmed cell death, in various cancer cell lines. It functions by activating the intrinsic apoptotic pathway, leading to the activation of caspases and subsequent cell death. Apoptosis Activator 2 has been investigated for its potential therapeutic applications in cancer treatment, particularly as a sensitizer to enhance the efficacy of chemotherapy or radiation therapy. Further research is needed to fully understand its mechanism of action and evaluate its potential in clinical settings.
CAS Number | 79183-19-0 |
Synonyms | 1-[(3,4-dichlorophenyl)methyl]indole-2,3-dione |
Molecular Formula | C15H9Cl2NO2 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≥ 46 mg/mL |
Storage | store at -20℃ |
IC50 | 4-9 uM(Leukemia origin cells)[1] |
IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]indole-2,3-dione |
InChI | InChI=1S/C15H9Cl2NO2/c16-11-6-5-9(7-12(11)17)8-18-13-4-2-1-3-10(13)14(19)15(18)20/h1-7H,8H2 |
InChIKey | KGRJPLRFGLMQMV-UHFFFAOYSA-N |
SMILES | O=C1C(C2=CC=CC=C2N1CC3=CC=C(Cl)C(Cl)=C3)=O |