For research use only. Not for therapeutic Use.
Apramycin(CAT: I003371) is an aminoglycoside antibiotic primarily used in veterinary medicine to treat bacterial infections in livestock. It functions by binding to the 30S ribosomal subunit, leading to the inhibition of protein synthesis and ultimately causing bacterial cell death. Apramycin exhibits strong activity against Gram-negative bacteria, including Escherichia coli and Salmonella species, and some Gram-positive bacteria. Due to its unique structure, Apramycin shows reduced susceptibility to common aminoglycoside resistance mechanisms. It is also being explored in antimicrobial resistance research as a potential treatment for multidrug-resistant bacterial infections in humans.
| Catalog Number | I003371 |
| CAS Number | 37321-09-8 |
| Molecular Formula | C21H41N5O11 |
| Purity | ≥95% |
| Target | Apramycin stands out among aminoglycosides for its mechanism of action which is based on blocking translocation and its ability to bind also to the eukaryotic decoding site despite differences in key residues required for apramycin recognition by the |
| Solubility | 10 mM in DMSO |
| Storage | Desiccate at +4C |
| IUPAC Name | (2R,3R,4S,5S,6S)-2-[[(2R,3S,4R,4aR,6S,7R,8aS)-7-amino-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxy-4-hydroxy-3-(methylamino)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]oxy]-5-amino-6-(hydroxymethyl)oxane-3,4-diol |
| InChI | InChI=1S/C21H41N5O11/c1-26-11-14(30)18-8(33-20(11)37-21-16(32)13(29)10(25)9(4-27)34-21)3-7(24)19(36-18)35-17-6(23)2-5(22)12(28)15(17)31/h5-21,26-32H,2-4,22-25H2,1H3/t5-,6+,7-,8+,9-,10-,11+,12+,13+,14-,15-,16-,17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | XZNUGFQTQHRASN-XQENGBIVSA-N |
| SMILES | CN[C@H]1[C@H]([C@@H]2[C@H](C[C@H]([C@H](O2)O[C@@H]3[C@H](C[C@H]([C@@H]([C@H]3O)O)N)N)N)O[C@@H]1O[C@@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)N)O)O)O |
