For research use only. Not for therapeutic Use.
Aprilkalim（Cat No.:M115109） is a chemical compound. This compound is known to act as a potassium channel opener, which means it helps to facilitate the movement of potassium ions through cellular membranes. This action can have various physiological effects, particularly in the cardiovascular system, where potassium channel openers are investigated for their potential to treat conditions like hypertension. Aprilkalim, specifically, has been studied for its potential applications in managing cardiovascular diseases, showcasing its relevance in therapeutic research and pharmaceutical development.
| Catalog Number | M115109 |
| CAS Number | 132562-26-6 |
| Synonyms | (R)-N-Methyl-2-(3-pyridinyl)-3,4,5,6-tetrahydro-2H-thiopyran-2-carbothioamide 1-oxide;Aprilkalim |
| Molecular Formula | C12H16N2OS2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2R)-N-methyl-1-oxo-2-pyridin-3-ylthiane-2-carbothioamide |
| InChI | InChI=1S/C12H16N2OS2/c1-13-11(16)12(6-2-3-8-17(12)15)10-5-4-7-14-9-10/h4-5,7,9H,2-3,6,8H2,1H3,(H,13,16)/t12-,17?/m1/s1 |
| InChIKey | GKEMHVLBZNVZOI-MTATWXBHSA-N |
| SMILES | CNC(=S)C1(CCCCS1=O)C2=CN=CC=C2 |
