Aprocitentan-d4 is a high-purity deuterated compound essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of Aprocitentan is pivotal for studies involving endothelin receptor antagonists, hypertension therapy, and drug metabolism analysis. Featuring four deuterium atoms, it ensures precise and reliable analytical results. Its advanced formulation provides enhanced stability and consistency, making it suitable for various experimental setups. Ideal for cardiovascular research and drug development, Aprocitentan-d4 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | S001033 |
| Molecular Formula | C16H10D4Br2N6O4S |
| Purity | ≥95% |
| IUPAC Name | 5-(4-bromophenyl)-4-[2-(5-bromopyrimidin-2-yl)oxy-1,1,2,2-tetradeuterioethoxy]-6-(sulfamoylamino)pyrimidine |
| InChI | InChI=1S/C16H14Br2N6O4S/c17-11-3-1-10(2-4-11)13-14(24-29(19,25)26)22-9-23-15(13)27-5-6-28-16-20-7-12(18)8-21-16/h1-4,7-9H,5-6H2,(H2,19,25,26)(H,22,23,24)/i5D2,6D2 |
| InChIKey | DKULOVKANLVDEA-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])OC1=NC=C(C=N1)Br)OC2=NC=NC(=C2C3=CC=C(C=C3)Br)NS(=O)(=O)N |
