Home
>
Catalysts and Ligands>Chiral phosphine ligands> (aR)-(1,2,3,4-Tetrahydroquinoline-1-yl)phosphonous acid 1,1'-binaphthalene-2,2'-diyl ester
For research use only. Not for therapeutic Use.
(aR)-(1,2,3,4-Tetrahydroquinoline-1-yl)phosphonous acid 1,1′-binaphthalene-2,2′-diyl ester (Cat.No:L003412) is a notable compound in organic synthesis. Its chiral structure, featuring a phosphonous acid group, plays a crucial role in asymmetric catalysis. This compound serves as a valuable building block for the creation of specialized molecules with potential applications in pharmaceuticals and agrochemicals, showcasing its significance in contemporary chemical research.
CAS Number | 1710694-47-5 |
Molecular Formula | C29H22NO2P |
Purity | ≥95% |
IUPAC Name | 1-(12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)-3,4-dihydro-2H-quinoline |
InChI | InChI=1S/C29H22NO2P/c1-4-12-23-20(8-1)15-17-26-28(23)29-24-13-5-2-9-21(24)16-18-27(29)32-33(31-26)30-19-7-11-22-10-3-6-14-25(22)30/h1-6,8-10,12-18H,7,11,19H2 |
InChIKey | YQTDEFANHFXFGX-UHFFFAOYSA-N |
SMILES | C1CC2=CC=CC=C2N(C1)P3OC4=C(C5=CC=CC=C5C=C4)C6=C(O3)C=CC7=CC=CC=C76 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |