For research use only. Not for therapeutic Use.
AR-C133913XX is a high-purity pharmaceutical compound used in advanced drug research. This selective receptor antagonist is essential for studying cardiovascular diseases and metabolic disorders. Its precise composition ensures reliable and reproducible results, making it indispensable for drug development and therapeutic investigations. Ideal for experimental setups, AR-C133913XX enhances research accuracy and efficacy in various scientific studies.
| Catalog Number | R024158 |
| CAS Number | 1251765-07-7 |
| Synonyms | (1S,2S,3R,5S)-3-[7-Amino-5-(propylthio)-3H-1,2,3-triazolo[4,5-d]pyrimidin-3-yl]-5-(2-hydroxyethoxy)-1,2-cyclopentanediol |
| Molecular Formula | C14H22N6O4S |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | (1S,2S,3R,5S)-3-(7-amino-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-5-(2-hydroxyethoxy)cyclopentane-1,2-diol |
| InChI | InChI=1S/C14H22N6O4S/c1-2-5-25-14-16-12(15)9-13(17-14)20(19-18-9)7-6-8(24-4-3-21)11(23)10(7)22/h7-8,10-11,21-23H,2-6H2,1H3,(H2,15,16,17)/t7-,8+,10+,11-/m1/s1 |
| InChIKey | YTYBSYIHUFBLKV-YKDSUIRESA-N |
| SMILES | CCCSC1=NC2=C(C(=N1)N)N=NN2C3CC(C(C3O)O)OCCO |
