For research use only. Not for therapeutic Use.
(+)-ar-Turmerone(CAT: R014970) is a sesquiterpene compound found in the essential oil of turmeric (Curcuma longa). Known for its bioactive properties, it has been studied for its anti-inflammatory, antioxidant, and neuroprotective effects. In pharmaceutical and biomedical research, (+)-ar-Turmerone has shown potential in promoting neural stem cell proliferation and aiding neurogenesis, making it a candidate for neurodegenerative disease therapies such as Alzheimer’s. Additionally, it has applications in organic chemistry as a natural product for synthesizing bioactive molecules and in the food industry as a flavoring agent with potential health benefits.
CAS Number | 532-65-0 |
Synonyms | (S)-ar-Turmerone; ar-(+)-Turmerone; ar-Tumerone; (S)-2-Methyl-6-(4-methylphenyl)-2-hepten-4-one;?2-Methyl-6-p-tolyl-2-hepten-4-one; ar-Turmerone; (+)-(S)-ar-Turmerone |
Molecular Formula | C15H20O |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | (6S)-2-methyl-6-(4-methylphenyl)hept-2-en-4-one |
InChI | InChI=1S/C15H20O/c1-11(2)9-15(16)10-13(4)14-7-5-12(3)6-8-14/h5-9,13H,10H2,1-4H3/t13-/m0/s1 |
InChIKey | NAAJVHHFAXWBOK-ZDUSSCGKSA-N |
SMILES | CC1=CC=C(C=C1)C(C)CC(=O)C=C(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |