For research use only. Not for therapeutic Use.
Arachidonoyl amide(CAT: I011522) is a natural compound and a member of the endocannabinoid family. Its action target involves interactions with cannabinoid receptors and other signaling pathways in the endocannabinoid system. The mode of action includes binding to cannabinoid receptors, such as CB1 and CB2, and modulating various physiological processes. Pharmacologically, arachidonoyl amide has shown promise in various medicinal applications, including its potential in pain modulation, inflammation regulation, and neuroprotection. As an endogenous lipid mediator, arachidonoyl amide plays a vital role in maintaining homeostasis and is being studied for its therapeutic potential in various diseases, including neurological disorders and chronic pain conditions.
CAS Number | 85146-53-8 |
Synonyms | 5Z,8Z,11Z,14Z-eicosatetraenamide |
Molecular Formula | C20H33NO |
Purity | ≥95% |
Target | Cannabinoid Receptor |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenamide |
InChI | InChI=1S/C20H33NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H2,21,22)/b7-6-,10-9-,13-12-,16-15- |
InChIKey | BNBSCAZCQDLUDU-DOFZRALJSA-N |
SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)N |