For research use only. Not for therapeutic Use.
Aragonite (Cat.No:M066531) is a crystalline form of calcium carbonate, commonly found in nature as a mineral. It’s a key component of shells, corals, and pearls, contributing to their structural strength. Aragonite has various industrial uses, including in cement production and as a soil conditioner in agriculture.
| Catalog Number | M066531 |
| CAS Number | 14791-73-2 |
| Molecular Formula | CH2CaO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | calcium;carbonic acid |
| InChI | InChI=1S/CH2O3.Ca/c2-1(3)4;/h(H2,2,3,4); |
| InChIKey | FYHXNYLLNIKZMR-UHFFFAOYSA-N |
| SMILES | C(=O)(O)O.[Ca] |
