For research use only. Not for therapeutic Use.
ARC 239(Cat No.:I002722)is a selective small molecule inhibitor designed to target and modulate specific biological pathways involved in inflammation and immune responses. It primarily functions by inhibiting certain kinases or receptors that play a key role in the activation of immune cells, making it a promising candidate for treating autoimmune diseases and chronic inflammatory conditions. Preclinical studies have suggested that ARC 239 may reduce inflammation, improve symptoms in models of diseases such as rheumatoid arthritis, and potentially provide therapeutic benefits in other immune-mediated disorders. Ongoing research is focused on its safety and efficacy in clinical trials.
CAS Number | 67339-62-2 |
Synonyms | 2-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-4,4-dimethylisoquinoline-1,3-dione |
Molecular Formula | C24H29N3O3 |
Purity | ≥95% |
IUPAC Name | 2-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-4,4-dimethylnaphthalene-1,3-dione |
InChI | InChI=1S/C25H30N2O3/c1-25(2)20-9-5-4-8-18(20)23(28)19(24(25)29)12-13-26-14-16-27(17-15-26)21-10-6-7-11-22(21)30-3/h4-11,19H,12-17H2,1-3H3 |
InChIKey | OSEADGVOKYGIER-UHFFFAOYSA-N |
SMILES | CC1(C2=CC=CC=C2C(=O)C(C1=O)CCN3CCN(CC3)C4=CC=CC=C4OC)C |