For research use only. Not for therapeutic Use.
ARC12（Cat No.:I041139）is a potent and selective inhibitor of the ARF GTPase-activating protein (GAP), which regulates the ARF family of small GTPases involved in vesicle trafficking, cell signaling, and membrane dynamics. By inhibiting ARC12, this compound modulates cellular processes such as endocytosis and intracellular trafficking, potentially offering therapeutic benefits in cancer, neurological disorders, and diseases related to dysregulated cell signaling. ARC12 is under investigation for its ability to control cellular functions linked to tumor progression and other conditions, making it a promising candidate for targeted therapeutic interventions.
| CAS Number | 64433-38-1 |
| Synonyms | 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzoic acid |
| Molecular Formula | C22H18N2O2 |
| Purity | ≥95% |
| IUPAC Name | 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzoic acid |
| InChI | InChI=1S/C22H18N2O2/c25-22(26)18-11-13-19(14-12-18)24-21(17-9-5-2-6-10-17)15-20(23-24)16-7-3-1-4-8-16/h1-14,21H,15H2,(H,25,26) |
| InChIKey | LRYRYLONUXSKTL-UHFFFAOYSA-N |
| SMILES | C1C(N(N=C1C2=CC=CC=C2)C3=CC=C(C=C3)C(=O)O)C4=CC=CC=C4 |
