For research use only. Not for therapeutic Use.
Arecaidine Propargyl Ester Hydrobromide (APE) is a chemical compound used in neuroscience research, particularly in studying acetylcholine receptors and their modulation. As an ester derivative of arecaidine, APE acts as a selective agonist for certain muscarinic acetylcholine receptor subtypes. Its ability to influence receptor activity makes it valuable for investigating neurotransmitter pathways and the role of cholinergic systems in neurological functions. APE contributes to advancements in neuropharmacology, aiding in the development of therapeutic agents targeting cognitive and neurodegenerative disorders.
| Catalog Number | M026242 |
| CAS Number | 116511-28-5 |
| Molecular Formula | C10H14BrNO2 |
| Purity | ≥95% |
| Storage | Desiccate at +4C |
| IUPAC Name | prop-2-ynyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate;hydrobromide |
| InChI | InChI=1S/C10H13NO2.BrH/c1-3-7-13-10(12)9-5-4-6-11(2)8-9;/h1,5H,4,6-8H2,2H3;1H |
| InChIKey | LRPUAFALRBYLTA-UHFFFAOYSA-N |
| SMILES | CN1CCC=C(C1)C(=O)OCC#C.Br |
