For research use only. Not for therapeutic Use.
Arecoline hydrobromide(Cat No.:A000870)is a potent alkaloid derived from the betel nut. It acts as a cholinergic agonist, stimulating acetylcholine receptors in the nervous system. This compound is primarily used in scientific research to study its effects on cognitive functions and neurological conditions. Arecoline hydrobromide has shown potential in enhancing memory and learning in animal models, making it a valuable tool in Alzheimer’s disease research. Additionally, it exhibits antiparasitic properties and has been investigated for its role in treating helminthic infections. However, its use requires careful handling due to its potent biological activity.
CAS Number | 300-08-3 |
Synonyms | NA |
Molecular Formula | C₈H₁₃NO₂ • HBr |
Purity | ≥95% |
Target | AChR |
Solubility | Soluble in DMSO |
Storage | 3 years -20C powder |
IUPAC Name | methyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate;hydrobromide |
InChI | InChI=1S/C8H13NO2.BrH/c1-9-5-3-4-7(6-9)8(10)11-2;/h4H,3,5-6H2,1-2H3;1H |
InChIKey | AXOJRQLKMVSHHZ-UHFFFAOYSA-N |
SMILES | CN1CCC=C(C1)C(=O)OC.Br |