For research use only. Not for therapeutic Use.
Argininic acid is an α-amino acid that is used in the biosynthesis of proteins.
Argininic acid (Arginine) contains an α-amino group, an α-carboxylic acid group, and a side chain consisting of a 3-carbon aliphatic straight chain ending in a guanidino group. In humans, arginine is classified as a semiessential or conditionally essential amino acid, depending on the developmental stage and health status of the individual.
| Catalog Number | R036102 |
| CAS Number | 157-07-3 |
| Synonyms | (2S)-5-(diaminomethylideneamino)-2-hydroxypentanoic acid |
| Molecular Formula | C6H13N3O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C6H13N3O3/c7-6(8)9-3-1-2-4(10)5(11)12/h4,10H,1-3H2,(H,11,12)(H4,7,8,9)/t4-/m0/s1 |
| InChIKey | BMFMQGXDDJALKQ-BYPYZUCNSA-N |
| SMILES | C(CC(C(=O)O)O)CN=C(N)N |
