For research use only, not for therapeutic use.
Aristolactam I(CAT: R058062) is a natural compound found in some plant species, particularly in the Aristolochia genus. Its mode of action involves being an alkaloid with potential biological activities. Pharmacologically, aristolactam I has been studied for its various effects, including genotoxicity and carcinogenicity. It has been associated with DNA adduct formation and has raised concerns about its potential to cause mutations and cancer in animal and in vitro studies.
| Catalog Number | R058062 |
| CAS Number | 13395-02-3 |
| Synonyms | 8-Methoxybenzo[f]-1,3-benzodioxolo[6,5,4-cd]indol-5(6H)-one; ?Aristolactam; Aristolactam I; Aristololactam; Aristololactam I; NSC 87406; |
| Molecular Formula | C17H11NO4 |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C17H11NO4/c1-20-12-4-2-3-8-9(12)5-11-14-10(17(19)18-11)6-13-16(15(8)14)22-7-21-13/h2-6H,7H2,1H3,(H,18,19) |
| InChIKey | MXOKGWUJNGEKBH-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C3C4=C(C=C21)NC(=O)C4=CC5=C3OCO5 |
