For research use only. Not for therapeutic Use.
Arjunolic Acid is a high-purity triterpenoid compound essential for advanced pharmaceutical and biochemical research. This natural product is crucial for studies involving antioxidant activity, cardioprotection, and anti-inflammatory properties. Known for its stability and bioactivity, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
| Catalog Number | R018834 |
| CAS Number | 465-00-9 |
| Molecular Formula | C30H48O5 |
| Purity | ≥95% |
| Target | NF-κB |
| Storage | 3 years -20C powder |
| IUPAC Name | (4aS,6aR,6aS,6bR,8aR,9R,10R,11R,12aR,14bS)-10,11-dihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| InChI | InChI=1S/C30H48O5/c1-25(2)11-13-30(24(34)35)14-12-28(5)18(19(30)15-25)7-8-22-26(3)16-20(32)23(33)27(4,17-31)21(26)9-10-29(22,28)6/h7,19-23,31-33H,8-17H2,1-6H3,(H,34,35)/t19-,20+,21+,22+,23-,26-,27-,28+,29+,30-/m0/s1 |
| InChIKey | RWNHLTKFBKYDOJ-DDHMHSPCSA-N |
| SMILES | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(C)CO)O)O)C)C)C2C1)C)C(=O)O)C |
