For research use only. Not for therapeutic Use.
ARL 17477(Cat No.:I010740)is a small molecule compound that is being studied for its potential therapeutic applications, particularly in the field of oncology. It functions as an inhibitor of specific signaling pathways involved in cancer cell growth, survival, and metastasis. By targeting key proteins and enzymes, ARL 17477 disrupts tumor cell proliferation and may enhance the effectiveness of existing cancer treatments. Research is ongoing to assess its efficacy, safety, and potential for treating a variety of cancers, particularly those with resistant or aggressive forms. If successful, ARL 17477 could provide a new avenue for cancer therapy.
CAS Number | 866914-87-6 |
Synonyms | N’-[4-[2-[(3-chlorophenyl)methylamino]ethyl]phenyl]thiophene-2-carboximidamide;dihydrochloride |
Molecular Formula | C20H22Cl3N3S |
Purity | ≥95% |
IUPAC Name | N'-[4-[2-[(3-chlorophenyl)methylamino]ethyl]phenyl]thiophene-2-carboximidamide;dihydrochloride |
InChI | InChI=1S/C20H20ClN3S.2ClH/c21-17-4-1-3-16(13-17)14-23-11-10-15-6-8-18(9-7-15)24-20(22)19-5-2-12-25-19;;/h1-9,12-13,23H,10-11,14H2,(H2,22,24);2*1H |
InChIKey | SOXBYIKSUDXMIE-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)Cl)CNCCC2=CC=C(C=C2)N=C(C3=CC=CS3)N.Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |