For research use only. Not for therapeutic Use.
ARM1（Cat No.:I011648）is a protein involved in cellular processes such as protein trafficking, cell signaling, and endocytosis. It acts as a component of the E3 ubiquitin ligase complex, playing a role in the regulation of protein degradation and turnover within the cell. ARM1 has been implicated in the modulation of cell cycle progression, cellular stress responses, and the maintenance of cellular homeostasis. In cancer research, ARM1’s influence on protein stability and signaling pathways makes it a potential target for therapeutic strategies aimed at disrupting abnormal cell growth and tumor progression.
| CAS Number | 68729-05-5 |
| Synonyms | 4-(4-benzylphenyl)-1,3-thiazol-2-amine |
| Molecular Formula | C16H14N2S |
| Purity | ≥95% |
| IUPAC Name | 4-(4-benzylphenyl)-1,3-thiazol-2-amine |
| InChI | InChI=1S/C16H14N2S/c17-16-18-15(11-19-16)14-8-6-13(7-9-14)10-12-4-2-1-3-5-12/h1-9,11H,10H2,(H2,17,18) |
| InChIKey | XYDVHKCVOMGRSY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=C(C=C2)C3=CSC(=N3)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
