For research use only. Not for therapeutic Use.
Armillarisin A(Cat No.:I015435)is a bioactive compound extracted from the fruiting bodies of Armillaria species, a type of mushroom. It has shown potential therapeutic properties, particularly in anticancer, anti-inflammatory, and antimicrobial research. Armillarisin A works by modulating specific signaling pathways involved in cell proliferation, apoptosis, and immune response. Studies suggest that it may inhibit the growth of cancer cells and reduce inflammation, making it a promising candidate for the development of natural-based therapies. Ongoing research aims to better understand its mechanism of action, safety, and potential for use in treating various diseases.
CAS Number | 53696-74-5 |
Molecular Formula | C₁₂H₁₀O₅ |
Purity | ≥95% |
Target | Interleukin Related |
IUPAC Name | 3-acetyl-7-hydroxy-5-(hydroxymethyl)chromen-2-one |
InChI | InChI=1S/C12H10O5/c1-6(14)9-4-10-7(5-13)2-8(15)3-11(10)17-12(9)16/h2-4,13,15H,5H2,1H3 |
InChIKey | XVZWWNMZVZWQKU-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC2=C(C=C(C=C2OC1=O)O)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |