For research use only. Not for therapeutic Use.
ARN1468（Cat No.:I043336）is an investigational small molecule being studied for its potential therapeutic applications, particularly in the treatment of cancer. It is designed to target specific enzymes or molecular pathways involved in tumor growth, metastasis, and resistance to cell death. By inhibiting these key pathways, ARN1468 may help slow down or halt the progression of various cancers, including solid tumors. Ongoing research is focused on evaluating its efficacy, safety, and potential clinical benefits, with the goal of offering a novel treatment option for patients with cancers that are resistant to traditional therapies.
| CAS Number | 1381459-14-8 |
| Synonyms | [5-amino-1-[4-(trifluoromethoxy)phenyl]pyrazol-4-yl]-piperidin-4-ylmethanone |
| Molecular Formula | C16H17F3N4O2 |
| Purity | ≥95% |
| IUPAC Name | [5-amino-1-[4-(trifluoromethoxy)phenyl]pyrazol-4-yl]-piperidin-4-ylmethanone |
| InChI | InChI=1S/C16H17F3N4O2/c17-16(18,19)25-12-3-1-11(2-4-12)23-15(20)13(9-22-23)14(24)10-5-7-21-8-6-10/h1-4,9-10,21H,5-8,20H2 |
| InChIKey | OOUGXIZAHWLQEM-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(=O)C2=C(N(N=C2)C3=CC=C(C=C3)OC(F)(F)F)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
