For research use only. Not for therapeutic Use.
ARN25068（Cat No.:I043895）is a small molecule compound developed as a selective inhibitor of a specific protein target involved in cancer cell growth and survival. It works by blocking key signaling pathways essential for tumor proliferation and progression. Preclinical studies suggest that ARN25068 is effective in treating various cancers, including those resistant to conventional therapies. By targeting critical molecular pathways, ARN25068 aims to reduce the spread of cancer cells while minimizing damage to healthy tissue. Ongoing research is focused on evaluating its safety, efficacy, and potential for clinical use in oncology treatments.
| CAS Number | 2649882-80-2 |
| Synonyms | 2-N-benzyl-4-N-(5-cyclopropyl-1H-pyrazol-3-yl)thieno[3,2-d]pyrimidine-2,4-diamine |
| Molecular Formula | C19H18N6S |
| Purity | ≥95% |
| IUPAC Name | 2-N-benzyl-4-N-(5-cyclopropyl-1H-pyrazol-3-yl)thieno[3,2-d]pyrimidine-2,4-diamine |
| InChI | InChI=1S/C19H18N6S/c1-2-4-12(5-3-1)11-20-19-21-14-8-9-26-17(14)18(23-19)22-16-10-15(24-25-16)13-6-7-13/h1-5,8-10,13H,6-7,11H2,(H3,20,21,22,23,24,25) |
| InChIKey | TVUWQDLBEOZVOU-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=NN2)NC3=NC(=NC4=C3SC=C4)NCC5=CC=CC=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
