For research use only. Not for therapeutic Use.
ARN726（Cat No.:I022452）is a selective small molecule inhibitor that targets specific enzymes involved in the regulation of immune responses and inflammation. It works by modulating key signaling pathways, particularly those related to immune cell activation and cytokine production. Preclinical studies have demonstrated its potential in treating autoimmune diseases, such as rheumatoid arthritis, and inflammatory conditions by reducing excessive immune system activity. ARN726 has shown promise in selectively inhibiting targets without broad immune suppression, potentially offering a safer therapeutic option with fewer side effects for chronic inflammatory diseases.
| CAS Number | 1628343-77-0 |
| Synonyms | 4-cyclohexylbutyl N-[(3S)-2-oxoazetidin-3-yl]carbamate |
| Molecular Formula | C14H24N2O3 |
| Purity | ≥95% |
| IUPAC Name | 4-cyclohexylbutyl N-[(3S)-2-oxoazetidin-3-yl]carbamate |
| InChI | InChI=1S/C14H24N2O3/c17-13-12(10-15-13)16-14(18)19-9-5-4-8-11-6-2-1-3-7-11/h11-12H,1-10H2,(H,15,17)(H,16,18)/t12-/m0/s1 |
| InChIKey | FNLUJRBWJBUJTC-LBPRGKRZSA-N |
| SMILES | C1CCC(CC1)CCCCOC(=O)N[C@H]2CNC2=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
