For research use only. Not for therapeutic Use.
Aroclor 1254, a polychlorinated biphenyl (PCB) mixture, was extensively used in various industrial applications like electrical equipment and hydraulic systems for its insulating properties. However, its persistence in the environment and toxic effects on human health led to its widespread ban. Despite regulatory actions, Aroclor 1254 residues still persist in soil, water, and wildlife, posing long-term risks. Remediation efforts aim to mitigate its environmental impact, emphasizing the need for continued monitoring and strict regulations to prevent further contamination and safeguard ecosystems and human well-being.
| Catalog Number | R069280 |
| CAS Number | 11097-69-1 |
| Synonyms | Polychlorinated biphenyl-54% chlorine |
| Molecular Formula | C12H5Cl5 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 1,2,3-trichloro-4-(2,3-dichlorophenyl)benzene |
| InChI | InChI=1S/C12H5Cl5/c13-8-3-1-2-6(10(8)15)7-4-5-9(14)12(17)11(7)16/h1-5H |
| InChIKey | AUGNBQPSMWGAJE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=C(C(=C(C=C2)Cl)Cl)Cl |
