For research use only. Not for therapeutic Use.
Arochlor 1260 (Cat.No:R069281) is a commercial mixture of polychlorinated biphenyls (PCBs). PCBs are synthetic organic chemicals that were used in various industrial applications, such as electrical transformers and capacitors.
CAS Number | 11096-82-5 |
Synonyms | Polychlorinated biphenyl-60% chlorine |
Molecular Formula | C12H4Cl6 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 1,2,3-trichloro-4-(2,3,4-trichlorophenyl)benzene |
InChI | InChI=1S/C12H4Cl6/c13-7-3-1-5(9(15)11(7)17)6-2-4-8(14)12(18)10(6)16/h1-4H |
InChIKey | BTAGRXWGMYTPBY-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1C2=C(C(=C(C=C2)Cl)Cl)Cl)Cl)Cl)Cl |