For research use only. Not for therapeutic Use.
Aroclor 5460 (Cat.No:R069287) is a complex mixture of polychlorinated biphenyls (PCBs) used as dielectric fluids and insulating materials in electrical equipment. Due to their environmental persistence and toxicity, Aroclor compounds have been largely banned. They pose health risks and are subject to strict regulations and environmental monitoring.
| Catalog Number | R069287 |
| CAS Number | 11126-42-4 |
| Synonyms | Polychlorinated triphenyl (aroclor 5460) |
| Molecular Formula | C18H5Cl9 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 1,3,4-trichloro-5-(2,3,5-trichlorophenyl)-2-(3,4,5-trichlorophenyl)benzene |
| InChI | InChI=1S/C18H5Cl9/c19-7-3-8(15(24)13(23)4-7)9-5-10(20)14(18(27)16(9)25)6-1-11(21)17(26)12(22)2-6/h1-5H |
| InChIKey | PPBRFJLRPRQPEC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)Cl)Cl)C2=C(C=C(C(=C2Cl)Cl)C3=CC(=CC(=C3Cl)Cl)Cl)Cl |
