For research use only. Not for therapeutic Use.
Aromadendrene(Cat No.:I041049)is a sesquiterpene hydrocarbon found in various essential oils, particularly those derived from plants like Eucalyptus, Citrus, and Pinus. It has a characteristic woody, earthy, and slightly floral aroma, making it useful in fragrances and aromatherapy. Aromadendrene is known for its potential antimicrobial, anti-inflammatory, and antioxidant properties, which have sparked interest in its use in natural health products. It also plays a role in the defense mechanisms of plants, repelling herbivores and pathogens. Its versatile chemical profile makes it a valuable compound in both industry and research.
CAS Number | 489-39-4 |
Synonyms | (1aR,4aR,7R,7aR,7bS)-1,1,7-trimethyl-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulene |
Molecular Formula | C15H24 |
Purity | ≥95% |
IUPAC Name | (1aR,4aR,7R,7aR,7bS)-1,1,7-trimethyl-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulene |
InChI | InChI=1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h10-14H,1,5-8H2,2-4H3/t10-,11+,12-,13-,14-/m1/s1 |
InChIKey | ITYNGVSTWVVPIC-XVIXHAIJSA-N |
SMILES | C[C@@H]1CC[C@@H]2[C@@H]1[C@H]3[C@H](C3(C)C)CCC2=C |