For research use only. Not for therapeutic Use.
Aromadendrin(CAT: R001990) is a natural flavonoid compound found in certain plant sources, particularly in various species of plants in the Citrus genus. Its mode of action involves being a flavonoid with potential biological activities. Aromadendrin has been studied for its potential pharmacological properties, including antioxidant, anti-inflammatory, and anticancer effects. As a flavonoid, it exhibits potential health-promoting properties and is of interest in medicinal research and herbal remedies.
CAS Number | 480-20-6 |
Molecular Formula | C15H12O6 |
Purity | ≥95% |
Target | Apoptosis |
Storage | Store at -20°C |
IUPAC Name | (2R,3R)-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
InChI | InChI=1S/C15H12O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,14-18,20H/t14-,15+/m0/s1 |
InChIKey | PADQINQHPQKXNL-LSDHHAIUSA-N |
SMILES | C1=CC(=CC=C1C2C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |