For research use only. Not for therapeutic Use.
ARS-1323, the racemate of ARS-1620, is a novel inhibitor of mutant K-ras G12C extracted from patent WO 2015054572 A1.
| Catalog Number | I020449 |
| CAS Number | 1698024-73-5 |
| Synonyms | 1-[4-[6-chloro-8-fluoro-7-(2-fluoro-6-hydroxyphenyl)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| Molecular Formula | C21H17ClF2N4O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C21H17ClF2N4O2/c1-2-16(30)27-6-8-28(9-7-27)21-12-10-13(22)17(19(24)20(12)25-11-26-21)18-14(23)4-3-5-15(18)29/h2-5,10-11,29H,1,6-9H2 |
| InChIKey | ZRPZPNYZFSJUPA-UHFFFAOYSA-N |
| SMILES | C=CC(=O)N1CCN(CC1)C2=NC=NC3=C(C(=C(C=C32)Cl)C4=C(C=CC=C4F)O)F |
| Reference | [1]. Liansheng Li, et al. Inhibitors of kras g12c. WO 2015054572 A1. |
