For research use only. Not for therapeutic Use.
Arteannuin B(Cat No.:R044768)is a natural sesquiterpene lactone isolated from Artemisia annua, a plant known for its antimalarial properties. This compound has demonstrated significant anticancer, anti-inflammatory, and antioxidant activities, making it a promising candidate for various therapeutic applications. Arteannuin B selectively targets cancer cells by inducing apoptosis and inhibiting cell proliferation, particularly in breast, lung, and liver cancers. It also enhances immune responses and modulates several signaling pathways, including NF-κB and MAPK. With its potent bioactivity, Arteannuin B continues to be studied for its potential in cancer therapy and immune modulation.
CAS Number | 50906-56-4 |
Molecular Formula | C15H20O3 |
Purity | ≥95% |
Target | Apoptosis |
Storage | 3 years -20C powder |
IUPAC Name | (1R,5S,8R,9S,12R,14R)-8,12-dimethyl-4-methylidene-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-3-one |
InChI | InChI=1S/C15H20O3/c1-8-4-5-11-9(2)12(16)17-15(11)10(8)6-7-14(3)13(15)18-14/h8,10-11,13H,2,4-7H2,1,3H3/t8-,10+,11+,13-,14-,15-/m1/s1 |
InChIKey | QWQSMEDUZQDVLA-KPHNHPKPSA-N |
SMILES | C[C@@H]1CC[C@H]2C(=C)C(=O)O[C@]23[C@H]1CC[C@@]4([C@H]3O4)C |