For research use only. Not for therapeutic Use.
Artelinic acid(Cat No.:M028238), a derivative of artemisinin, is a valuable compound used in antimalarial research, particularly in combating multidrug resistance of Plasmodium falciparum, the malaria-causing parasite. Its flexibility allows for administration through various routes, such as intravenous, intramuscular, and oral, making it suitable for different treatment protocols. The compound’s association with artemisinin, a potent antimalarial drug, adds to its significance in malaria research, providing a potential solution to the challenge of drug-resistant strains of the parasite. Artelinic acid holds promise in advancing malaria treatment strategies and addressing the global burden of this infectious disease.
Catalog Number | M028238 |
CAS Number | 120020-26-0 |
Molecular Formula | C23H30O7 |
Purity | ≥95% |
Target | Parasite |
Storage | -20°C |
IUPAC Name | 4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]benzoic acid |
InChI | InChI=1S/C23H30O7/c1-13-4-9-18-14(2)20(26-12-15-5-7-16(8-6-15)19(24)25)27-21-23(18)17(13)10-11-22(3,28-21)29-30-23/h5-8,13-14,17-18,20-21H,4,9-12H2,1-3H3,(H,24,25)/t13-,14-,17+,18+,20+,21-,22-,23-/m1/s1 |
InChIKey | UVNHKOOJXSALHN-ILQPJIFQSA-N |
SMILES | CC1CCC2C(C(OC3C24C1CCC(O3)(OO4)C)OCC5=CC=C(C=C5)C(=O)O)C |