For research use only. Not for therapeutic Use.
Artemisic Acid(Cat No.:R027413)is a natural compound derived from the Artemisia annua plant, renowned for its role in the synthesis of artemisinin-based antimalarial drugs. Known for its sesquiterpene lactone structure, Artemisic Acid has demonstrated potent antimalarial and anti-inflammatory properties. It works by disrupting the malaria parasite’s cellular function, particularly effective against Plasmodium species. Beyond antimalarial applications, it is explored for potential anticancer and antimicrobial activities. As a precursor in drug synthesis, Artemisic Acid is invaluable in developing treatments for malaria, offering a foundation for bioactive compound discovery and therapeutic innovation.
CAS Number | 80286-58-4 |
Synonyms | 2-((1R,4R,4aS,8aS)-4,7-Dimethyldecahydronaphthalen-1-yl)acrylic Acid; [1R-(1α,4β,4aβ,8aβ)]-1,2,3,4,4a,5,6,8a-Octahydro-4,7-dimethyl-α-methylene-1-naphthaleneacetic Acid; (1R,4R,4aS,8aR)-1,2,3,4,4a,5,6,8a-Octahydro-4,7-dimethyl-α-methylene-1-napht |
Molecular Formula | C15H22O2 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C Freezer, Under inert atmosphere |
IUPAC Name | 2-[(1R,4R,4aS,8aR)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]prop-2-enoic acid |
InChI | InChI=1S/C15H22O2/c1-9-4-6-12-10(2)5-7-13(14(12)8-9)11(3)15(16)17/h8,10,12-14H,3-7H2,1-2H3,(H,16,17)/t10-,12+,13+,14+/m1/s1 |
InChIKey | PLQMEXSCSAIXGB-SAXRGWBVSA-N |
SMILES | CC1CCC(C2C1CCC(=C2)C)C(=C)C(=O)O |