For research use only. Not for therapeutic Use.
Artemisinin-d3(Cat No.:R008115)is a deuterium-labeled derivative of artemisinin, a naturally occurring antimalarial compound extracted from Artemisia annua. The incorporation of deuterium enhances its stability and allows for precise tracking in pharmacokinetic and metabolic studies. Artemisinin-d3 retains the potent antimalarial properties of artemisinin, targeting the parasite responsible for malaria, Plasmodium falciparum. This labeled compound is widely used in research to study drug metabolism, distribution, and efficacy, contributing to the development of improved antimalarial therapies and better understanding of artemisinin’s pharmacological behavior.
Catalog Number | R008115 |
CAS Number | 176652-07-6 |
Synonyms | (3R,5aS,6R,8aS,9R,12S,12aR)-Octahydro-3,6-dimethyl-9-(methyl-d3)-3,12-epox-12H-pyrano[4,3-j]-1,2-benzodioxepin-10(3H)-one; Artemisine-d3; Arteannuin-d3; Huanghuahaosu-d3; QHS-d3; |
Molecular Formula | C₁₅H₁₉D₃O₅ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (1R,4S,5R,8S,9R,12S,13R)-1,5-dimethyl-9-(trideuteriomethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
InChI | InChI=1S/C15H22O5/c1-8-4-5-11-9(2)12(16)17-13-15(11)10(8)6-7-14(3,18-13)19-20-15/h8-11,13H,4-7H2,1-3H3/t8-,9-,10+,11+,13-,14-,15-/m1/s1/i2D3 |
InChIKey | BLUAFEHZUWYNDE-OGUHANSASA-N |
SMILES | [2H]C([2H])([2H])[C@@H]1[C@@H]2CC[C@H]([C@H]3[C@]24[C@H](OC1=O)O[C@@](CC3)(OO4)C)C |