Artesunate is a water-soluble derivative of artemisinin, a potent antimalarial compound extracted from the plant Artemisia annua. Known for its rapid action against Plasmodium parasites, artesunate is particularly effective in treating severe malaria cases, including those resistant to traditional antimalarials. It works by generating reactive oxygen species within the parasite, leading to its death. Artesunate’s safety and efficacy have made it a cornerstone in malaria treatment protocols, especially in areas with high drug resistance.
Catalog Number | R008068 |
CAS Number | 88495-63-0 |
Synonyms | Butanedioic Acid Mono(3R,5aS,6R,8aS,9R,10R,12R,12aR)-decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10-yl] Ester; Artesunic Acid; |
Molecular Formula | C19H28O8 |
Purity | 95% |
Target | viral inhibitor |
Storage | 3 years -20C powder |
InChI | InChI=1S/C19H28O8/c1-10-4-5-13-11(2)16(23-15(22)7-6-14(20)21)24-17-19(13)12(10)8-9-18(3,25-17)26-27-19/h10-13,16-17H,4-9H2,1-3H3,(H,20,21)/t10-,11-,12+,13+,16-,17-,18-,19-/m1/s1 |
InChIKey | FIHJKUPKCHIPAT-AHIGJZGOSA-N |
SMILES | [H][C@]12[C@@H](C)[C@H](OC(CCC(O)=O)=O)O[C@@]3([H])[C@@]1(OO4)[C@](CC[C@]4(C)O3)([H])[C@H](C)CC2 |