For research use only. Not for therapeutic Use.
Artonin E(Cat No.:M111050) is a natural compound classified as a prenylated flavonoid, primarily isolated from the bark of the plant Artocarpus elasticus. This compound has attracted interest due to its diverse pharmacological properties, including anti-cancer, anti-inflammatory, and antimicrobial activities. Antonin E interacts with cellular processes at the molecular level, showing particular promise in inhibiting the growth of various cancer cell lines. Its mechanism of action includes the modulation of key signaling pathways and induction of apoptosis in cancer cells.
CAS Number | 129683-93-8 |
Synonyms | artonin E |
Molecular Formula | C25H24O7 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | 5-hydroxy-8,8-dimethyl-3-(3-methylbut-2-enyl)-2-(2,4,5-trihydroxyphenyl)pyrano[2,3-h]chromen-4-one |
InChI | InChI=1S/C25H24O7/c1-12(2)5-6-14-22(30)21-19(29)11-20-13(7-8-25(3,4)32-20)24(21)31-23(14)15-9-17(27)18(28)10-16(15)26/h5,7-11,26-29H,6H2,1-4H3 |
InChIKey | HDHRTQZSBFUBMJ-UHFFFAOYSA-N |
SMILES | CC(=CCC1=C(OC2=C(C1=O)C(=CC3=C2C=CC(O3)(C)C)O)C4=CC(=C(C=C4O)O)O)C |