For research use only. Not for therapeutic Use.
ARUK3001185（Cat No.:I043662）is a small molecule inhibitor being developed for the treatment of neurodegenerative diseases, particularly Alzheimer’s disease. It targets key enzymes and signaling pathways involved in the buildup of toxic protein aggregates, such as amyloid-beta, which are characteristic of Alzheimer’s pathology. By modulating these processes, ARUK3001185 has shown potential in preclinical studies to reduce protein accumulation, improve cognitive function, and slow disease progression. Its specific mechanism of action offers a targeted approach to treating Alzheimer’s, with the goal of providing a more effective and selective treatment for patients.
| CAS Number | 2411969-39-4 |
| Synonyms | 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]triazole |
| Molecular Formula | C9H4Cl2F3N3 |
| Purity | ≥95% |
| IUPAC Name | 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]triazole |
| InChI | InChI=1S/C9H4Cl2F3N3/c10-5-1-2-6(17-4-3-15-16-17)8(11)7(5)9(12,13)14/h1-4H |
| InChIKey | XVFXHCLMGYJAQI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N2C=CN=N2)Cl)C(F)(F)F)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
