For research use only. Not for therapeutic Use.
AS408(Cat No.:I022496)is an experimental drug developed by Asana BioSciences, primarily being researched for its potential in treating inflammatory and autoimmune diseases. It works by targeting specific pathways involved in immune system regulation, aiming to reduce inflammation and tissue damage. AS408 is a small molecule that selectively inhibits certain kinases responsible for the activation of immune cells, potentially offering a more targeted approach to controlling diseases like rheumatoid arthritis and lupus. While early clinical studies show promise, further research is needed to establish its safety, efficacy, and long-term benefits.
CAS Number | 2378521-26-5 |
Synonyms | AS408; AS 408; AS-408; |
Molecular Formula | C14H11BrN4 |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | 6-bromo-2-N-phenylquinazoline-2,4-diamine |
InChI | InChI=1S/C14H11BrN4/c15-9-6-7-12-11(8-9)13(16)19-14(18-12)17-10-4-2-1-3-5-10/h1-8H,(H3,16,17,18,19) |
InChIKey | MPGNABXYXOGUGH-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)NC2=NC3=C(C=C(C=C3)Br)C(=N2)N |