For research use only. Not for therapeutic Use.
Asaraldehyde(Cat No.: I003578), is a natural compound known for its ability to inhibit cyclooxygenase-2 (COX-2), an enzyme involved in inflammation and pain. It exhibits notable selectivity, with a 17-fold preference for inhibiting COX-2 over COX-1, which helps minimize unwanted side effects associated with non-selective COX inhibitors. Additionally, 2,4,5-Trimethoxybenzaldehyde, a component of asaraldehyde, is utilized as a pharmaceutical intermediate. Its primary application lies in the synthesis of asarone, a compound with potential medicinal properties. Asaraldehyde’s anti-inflammatory properties make it valuable in research and potentially for the development of anti-inflammatory drugs.
Catalog Number | I003578 |
CAS Number | 4460-86-0 |
Synonyms | 2,4,5-trimethoxybenzaldehyde |
Molecular Formula | C10H12O4 |
Purity | ≥95% |
Target | COX |
Solubility | 10 mM in DMSO |
Storage | Room Temperature |
IUPAC Name | 2,4,5-trimethoxybenzaldehyde |
InChI | InChI=1S/C10H12O4/c1-12-8-5-10(14-3)9(13-2)4-7(8)6-11/h4-6H,1-3H3 |
InChIKey | IAJBQAYHSQIQRE-UHFFFAOYSA-N |
SMILES | COC1=CC(=C(C=C1C=O)OC)OC |