For research use only. Not for therapeutic Use.
ASB14780（Cat No.:I022502）is an investigational small molecule compound being studied for its potential therapeutic applications, particularly in oncology. It targets specific proteins or signaling pathways involved in cancer cell proliferation, survival, and metastasis. By inhibiting these key pathways, ASB14780 may help slow tumor growth, reduce metastasis, and enhance the effectiveness of existing cancer treatments. Ongoing research is focused on evaluating its efficacy, safety, and potential to treat various cancer types, including solid tumors and hematological malignancies. ASB14780 could represent a promising new therapeutic option for patients with resistant or advanced cancers.
| CAS Number | 1069046-00-9 |
| Synonyms | 2-amino-2-(hydroxymethyl)propane-1,3-diol;3-[1-(4-phenoxyphenyl)-3-(2-phenylethyl)indol-5-yl]propanoic acid |
| Molecular Formula | C35H38N2O6 |
| Purity | ≥95% |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;3-[1-(4-phenoxyphenyl)-3-(2-phenylethyl)indol-5-yl]propanoic acid |
| InChI | InChI=1S/C31H27NO3.C4H11NO3/c33-31(34)20-13-24-12-19-30-29(21-24)25(14-11-23-7-3-1-4-8-23)22-32(30)26-15-17-28(18-16-26)35-27-9-5-2-6-10-27;5-4(1-6,2-7)3-8/h1-10,12,15-19,21-22H,11,13-14,20H2,(H,33,34);6-8H,1-3,5H2 |
| InChIKey | MBPXGBINIINSEU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=CN(C3=C2C=C(C=C3)CCC(=O)O)C4=CC=C(C=C4)OC5=CC=CC=C5.C(C(CO)(CO)N)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
