For research use only. Not for therapeutic Use.
Ascochlorin is a natural isoprenoid antibiotic produced by certain fungal species, particularly Ascochyta viciae. It exhibits a broad range of biological activities, including anticancer, antiviral, and anti-inflammatory properties. Ascochlorin inhibits mitochondrial electron transport and regulates cellular signaling pathways, making it a compound of interest in pharmaceutical research. Its unique structure and bioactivity have led to its investigation as a potential therapeutic agent for treating cancer, cardiovascular diseases, and infections, highlighting its significance in drug discovery and development.
CAS Number | 26166-39-2 |
Synonyms | Antibiotic LL-Z1272γ;Ilicicolin D;NSC 287492 |
Molecular Formula | C23H29CIO4 |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Appearance | White Powder |
Storage | -20°C |
IUPAC Name | 5-chloro-2,4-dihydroxy-6-methyl-3-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]benzaldehyde |
InChI | InChI=1S/C23H29ClO4/c1-13(10-11-23(5)14(2)7-9-19(26)16(23)4)6-8-17-21(27)18(12-25)15(3)20(24)22(17)28/h6,10-12,14,16,27-28H,7-9H2,1-5H3/b11-10+,13-6+/t14-,16+,23+/m1/s1 |
InChIKey | SETVRSKZJJWOPA-FLDGXQSCSA-N |
SMILES | CC1CCC(=O)C(C1(C)C=CC(=CCC2=C(C(=C(C(=C2O)Cl)C)C=O)O)C)C |