For research use only. Not for therapeutic Use.
Ascr#18, an ascaroside, is a hormone of nematodes. Ascr#18 is expressed during nematode development. Ascr#18 increases resistance in Arabidopsis, tomato, potato and barley to viral, bacterial, oomycete, fungal and nematode infections[1].
Ascr#18 (0.1-10 μM; pretreated 24 h) enhances pathogen resistance and activates defense responses in Arabidopsis[1].
| Catalog Number | I044813 |
| CAS Number | 1355681-10-5 |
| Synonyms | (10R)-10-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxyundecanoic acid |
| Molecular Formula | C17H32O6 |
| Purity | ≥95% |
| InChI | InChI=1S/C17H32O6/c1-12(9-7-5-3-4-6-8-10-16(20)21)22-17-15(19)11-14(18)13(2)23-17/h12-15,17-19H,3-11H2,1-2H3,(H,20,21)/t12-,13+,14-,15-,17-/m1/s1 |
| InChIKey | AHRWSOYISAIFOZ-JRBZFYFNSA-N |
| SMILES | CC1C(CC(C(O1)OC(C)CCCCCCCCC(=O)O)O)O |
| Reference | [1]. Manosalva P, et, al. Conserved nematode signalling molecules elicit plant defenses and pathogen resistance. Nat Commun. 2015 Jul 23;6:7795. |
